Compound Q&A

How should (2,4-Difluorophenyl)(phenyl)methanone (CAS: 85068-35-5) be stored?

Answer

(2,4-Difluorophenyl)(phenyl)methanone
(2,4-Difluorophenyl)(phenyl)methanone should be stored in a cool, dry place, away from direct sunlight and heat sources. It should be kept in a tightly sealed, non-reactive container to prevent contamination and degradation. Adequate ventilation is essential when storing this compound.

About

CAS No 85068-35-5
English Name (2,4-Difluorophenyl)(phenyl)methanone
Molecular Formula C13H8F2O
Molecular Weight 218.2 g/mol
SMILES c1ccc(cc1)C(=O)c2ccc(cc2F)F
InChIKey FRHMSTHFVFIPCO-UHFFFAOYSA-N
Last Updated: 2025-09-12 19:41

Related Q&A

Compound Q&A

What is (2,4-Difluorophenyl)(phenyl)methanone (CAS: 85068-35-5)?

(2,4-Difluorophenyl)(phenyl)methanone, also known as 2,4-Difluoroanisole, is a colorless liquid used...

Compound Q&A

What are the main uses of (2,4-Difluorophenyl)(phenyl)methanone (CAS: 85068-35-5)?

(2,4-Difluorophenyl)(phenyl)methanone is primarily used in chemical synthesis, pharmaceutical interm...

Compound Q&A

Is (2,4-Difluorophenyl)(phenyl)methanone (CAS: 85068-35-5) safe?

(2,4-Difluorophenyl)(phenyl)methanone is generally considered safe for laboratory use when proper sa...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...