Compound Q&A

How should 2-Amino-5-chloro-4-methylbenzenesulfonic acid (CAS: 88-53-9) be stored?

Answer

2-Amino-5-chloro-4-methylbenzenesulfonic acid
2-Amino-5-chloro-4-methylbenzenesulfonic acid (CAS: 88-53-9) should be stored in a cool, dry place away from direct sunlight. Store it in a tightly sealed container to prevent moisture and contamination. Maintain a temperature below 25°C and avoid exposure to high humidity and light to ensure its stability and safety.

About

CAS No 88-53-9
English Name 2-Amino-5-chloro-4-methylbenzenesulfonic acid
Molecular Formula C7H8ClNO3S
Molecular Weight 221.67 g/mol
SMILES CC1=CC(=C(C=C1Cl)S(=O)(=O)O)N
InChIKey VYZCFAPUHSSYCC-UHFFFAOYSA-N
Last Updated: 2025-09-12 19:41

Related Q&A

Compound Q&A

What is 2-Amino-5-chloro-4-methylbenzenesulfonic acid (CAS: 88-53-9)?

2-Amino-5-chloro-4-methylbenzenesulfonic acid (CAS: 88-53-9) is an organic compound with the molecul...

Compound Q&A

What are the main uses of 2-Amino-5-chloro-4-methylbenzenesulfonic acid (CAS: 88-53-9)?

2-Amino-5-chloro-4-methylbenzenesulfonic acid (CAS: 88-53-9) is primarily used as an intermediate in...

Compound Q&A

Is 2-Amino-5-chloro-4-methylbenzenesulfonic acid (CAS: 88-53-9) safe?

2-Amino-5-chloro-4-methylbenzenesulfonic acid (CAS: 88-53-9) is generally considered safe when handl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...