Compound Q&A

What is 2-Amino-5-nitrobenzoic acid (CAS: 616-79-5)?

Answer

2-Amino-5-nitrobenzoic acid
2-Amino-5-nitrobenzoic acid (CAS: 616-79-5) is an organic compound with the molecular formula C7H7NO4. It is a white or slightly yellow crystalline solid with a characteristic odor.

About

CAS No 616-79-5
English Name 2-Amino-5-nitrobenzoic acid
Molecular Formula C7H6N2O4
Molecular Weight 182.13 g/mol
SMILES C1=CC(=C(C=C1[N+](=O)[O-])C(=O)O)N
InChIKey RUCHWTKMOWXHLU-UHFFFAOYSA-N
Last Updated: 2025-09-12 19:41

Related Q&A

Compound Q&A

What are the main uses of 2-Amino-5-nitrobenzoic acid (CAS: 616-79-5)?

2-Amino-5-nitrobenzoic acid is primarily used as a starting material in the synthesis of other organ...

Compound Q&A

Is 2-Amino-5-nitrobenzoic acid (CAS: 616-79-5) safe?

2-Amino-5-nitrobenzoic acid is generally considered safe under normal handling conditions, but it sh...

Compound Q&A

How should 2-Amino-5-nitrobenzoic acid (CAS: 616-79-5) be stored?

2-Amino-5-nitrobenzoic acid should be stored in a cool, dry place, away from direct sunlight and hea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...