Compound Q&A

What is 2-Methoxy-4-[(1E)-1-propen-1-yl]phenyl 2-methylpropanoate (CAS: 8007-70-3)?

Answer

2-Methoxy-4-[(1E)-1-propen-1-yl]phenyl 2-methylpropanoate
2-Methoxy-4-[(1E)-1-propen-1-yl]phenyl 2-methylpropanoate (CAS: 8007-70-3) is a complex organic compound, a type of ester. It is characterized by its ability to form stable carbon-carbon double bonds and has a molecular formula of C14H18O3. This compound is often used in pharmaceuticals and chemical synthesis for its reactivity and functional groups.

About

CAS No 8007-70-3
English Name 2-Methoxy-4-[(1E)-1-propen-1-yl]phenyl 2-methylpropanoate
Molecular Formula C14H18O3
Molecular Weight 234.29 g/mol
SMILES C/C=C/c1ccc(c(c1)OC)OC(=O)C(C)C
InChIKey HEOQGBRLGAJSLZ-AATRIKPKSA-N
Last Updated: 2025-09-12 19:41

Related Q&A

Compound Q&A

What are the main uses of 2-Methoxy-4-[(1E)-1-propen-1-yl]phenyl 2-methylpropanoate (CAS: 8007-70-3)?

2-Methoxy-4-[(1E)-1-propen-1-yl]phenyl 2-methylpropanoate (CAS: 8007-70-3) is primarily used in phar...

Compound Q&A

Is 2-Methoxy-4-[(1E)-1-propen-1-yl]phenyl 2-methylpropanoate (CAS: 8007-70-3) safe?

2-Methoxy-4-[(1E)-1-propen-1-yl]phenyl 2-methylpropanoate (CAS: 8007-70-3) is generally safe when ha...

Compound Q&A

How should 2-Methoxy-4-[(1E)-1-propen-1-yl]phenyl 2-methylpropanoate (CAS: 8007-70-3) be stored?

2-Methoxy-4-[(1E)-1-propen-1-yl]phenyl 2-methylpropanoate (CAS: 8007-70-3) should be stored in a coo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...