Compound Q&A

What is [(2,2-Dimethylpropanoyl)oxy]methyl (2S,5R)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate 4,4-dioxide (CAS: 69388-79-0)?

Answer

[(2,2-Dimethylpropanoyl)oxy]methyl (2S,5R)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate 4,4-dioxide
This compound is a complex organic molecule used primarily in pharmaceutical and research applications. It contains a thia-azabicyclic structure and a carboxylate group, making it useful for medicinal chemistry and as a precursor in synthesis of bioactive compounds.

About

CAS No 69388-79-0
English Name [(2,2-Dimethylpropanoyl)oxy]methyl (2S,5R)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate 4,4-dioxide
Molecular Formula C14H21NO7S
Molecular Weight 347.39 g/mol
SMILES CC1(C(N2C(S1(=O)=O)CC2=O)C(=O)OCOC(=O)C(C)(C)C)C
InChIKey OHPVYKXTRACOSQ-ZJUUUORDSA-N
Last Updated: 2025-09-12 19:41

Related Q&A

Compound Q&A

What are the main uses of [(2,2-Dimethylpropanoyl)oxy]methyl (2S,5R)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate 4,4-dioxide (CAS: 69388-79-0)?

This compound is mainly used in pharmaceutical research as a precursor for synthesizing other bioact...

Compound Q&A

Is [(2,2-Dimethylpropanoyl)oxy]methyl (2S,5R)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate 4,4-dioxide (CAS: 69388-79-0) safe?

This compound is generally considered safe for laboratory use when appropriate safety measures are f...

Compound Q&A

How should [(2,2-Dimethylpropanoyl)oxy]methyl (2S,5R)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate 4,4-dioxide (CAS: 69388-79-0) be stored?

Store the compound in a cool, dry, and well-ventilated area, away from direct sunlight and sources o...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...