Compound Q&A

What are the main uses of 3-Amino-2-naphthoic acid (CAS: 5959-52-4)?

Answer

3-Amino-2-naphthoic acid
3-Amino-2-naphthoic acid (CAS: 5959-52-4) is primarily used in the production of dyes, pharmaceuticals, and organic synthesis. It is also used as a reagent in analytical chemistry and as an intermediate for the synthesis of various organic compounds.

About

CAS No 5959-52-4
English Name 3-Amino-2-naphthoic acid
Molecular Formula C11H9NO2
Molecular Weight 187.2 g/mol
SMILES C1=CC=C2C=C(C(=CC2=C1)C(=O)O)N
InChIKey XFXOLBNQYFRSLQ-UHFFFAOYSA-N
Last Updated: 2025-09-12 19:41

Related Q&A

Compound Q&A

What is 3-Amino-2-naphthoic acid (CAS: 5959-52-4)?

3-Amino-2-naphthoic acid (CAS: 5959-52-4) is an organic compound with the molecular formula C10H7NO3...

Compound Q&A

Is 3-Amino-2-naphthoic acid (CAS: 5959-52-4) safe?

3-Amino-2-naphthoic acid (CAS: 5959-52-4) is generally safe when handled with proper precautions. It...

Compound Q&A

How should 3-Amino-2-naphthoic acid (CAS: 5959-52-4) be stored?

3-Amino-2-naphthoic acid (CAS: 5959-52-4) should be stored in a cool, dry place, away from direct su...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...