Compound Q&A

Are there alternatives to 7-Hydroxy-2-oxo-2H-chromene-3-carboxylic acid in synthesis?

Answer

7-Hydroxy-2-oxo-2H-chromene-3-carboxylic acid
There are several alternatives to 7-Hydroxy-2-oxo-2H-chromene-3-carboxylic acid (CAS: 779-27-1) in synthesis, depending on the desired properties and the specific reaction conditions. Common alternatives include other chromene derivatives such as 5-hydroxy-2-oxo-2H-chromene-3-carboxylic acid or related carboxylic acids. These alternatives can be used as substitutes in similar chemical reactions, providing similar functional groups for various applications.

About

CAS No 779-27-1
English Name 7-Hydroxy-2-oxo-2H-chromene-3-carboxylic acid
Molecular Formula C10H6O5
Molecular Weight 206.15 g/mol
SMILES C1=CC2=C(C=C1O)OC(=O)C(=C2)C(=O)O
InChIKey LKLWLDOUZJEHDY-UHFFFAOYSA-N
Last Updated: 2025-09-11 18:29

Related Q&A

Compound Q&A

What regulatory guidelines apply to 7-Hydroxy-2-oxo-2H-chromene-3-carboxylic acid (CAS: 779-27-1)?

7-Hydroxy-2-oxo-2H-chromene-3-carboxylic acid (CAS: 779-27-1) is subject to various regulatory guide...

Compound Q&A

What is the market or research trend for 7-Hydroxy-2-oxo-2H-chromene-3-carboxylic acid (CAS: 779-27-1)?

The market for 7-Hydroxy-2-oxo-2H-chromene-3-carboxylic acid (CAS: 779-27-1) is growing due to its a...

Compound Q&A

How should waste containing 7-Hydroxy-2-oxo-2H-chromene-3-carboxylic acid (CAS: 779-27-1) be handled?

Waste containing 7-Hydroxy-2-oxo-2H-chromene-3-carboxylic acid (CAS: 779-27-1) should be handled in ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...