Compound Q&A

Are there alternatives to (3S)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid (CAS: 129460-09-9) in synthesis?

Answer

(3S)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid
Yes, there are alternatives to this compound in synthesis. Common substitutes include chemically similar carboxylic acids or their derivatives. For example, using (3R)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid or (3S)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-hydroxybutanoic acid can be viable alternatives depending on the specific reaction conditions and desired product properties.

About

English Name (3S)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid
Molecular Formula C23H25NO6
Molecular Weight 411.45 g/mol
SMILES CC(C)(C)OC(=O)C(CC(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13
InChIKey VZXQYACYLGRQJU-IBGZPJMESA-N
Last Updated: 2025-09-11 18:29

Related Q&A

Compound Q&A

What regulatory guidelines apply to (3S)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid (CAS: 129460-09-9)?

This compound is subject to various regulatory guidelines, including those outlined in the Globally ...

Compound Q&A

What is the market or research trend for (3S)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid (CAS: 129460-09-9)?

The market for this compound is growing due to its use in pharmaceutical and biochemical research. R...

Compound Q&A

How should waste containing (3S)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid (CAS: 129460-09-9) be handled?

Waste containing this compound should be handled in accordance with local and international environm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...