Compound Q&A

Are there alternatives to 1,4-Butanedisulfonic acid in synthesis?

Answer

1,4-Butanedisulfonic acid
In synthesis, 1,4-Butanedisulfonic acid (CAS: 27665-39-0) can be replaced by other sulfonic acids such as benzenesulfonic acid or methanesulfonic acid. These alternatives offer similar functionality but may have different reactivity and handling requirements. The choice depends on the specific requirements of the synthesis process.

About

CAS No 27665-39-0
English Name 1,4-Butanedisulfonic acid
Molecular Formula C4H10O6S2
Molecular Weight 218.25199999999998 g/mol
SMILES C(CCS(=O)(=O)O)CS(=O)(=O)O
InChIKey VERAMNDAEAQRGS-UHFFFAOYSA-N
Last Updated: 2025-09-11 18:29

Related Q&A

Compound Q&A

What regulatory guidelines apply to 1,4-Butanedisulfonic acid (CAS: 27665-39-0)?

1,4-Butanedisulfonic acid (CAS: 27665-39-0) falls under the classification and labelling guidelines ...

Compound Q&A

What is the market or research trend for 1,4-Butanedisulfonic acid?

The market for 1,4-Butanedisulfonic acid (CAS: 27665-39-0) is growing due to its use in pharmaceutic...

Compound Q&A

How should waste containing 1,4-Butanedisulfonic acid be handled?

Waste containing 1,4-Butanedisulfonic acid (CAS: 27665-39-0) should be collected in appropriate cont...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...