Compound Q&A

Are there alternatives to (6Z,9Z,12Z)-6,9,12-Octadecatrienoic acid (CAS: 506-26-3) in synthesis?

Answer

(6Z,9Z,12Z)-6,9,12-Octadecatrienoic acid
Several alternatives to (6Z,9Z,12Z)-6,9,12-Octadecatrienoic acid (CAS: 506-26-3) can be used in synthesis, depending on the specific requirements of the reaction. Common alternatives include other conjugated trienoic acids, such as α-linolenic acid (CAS: 590-69-3), which can serve similar functions in various biochemical pathways. Isomers and structural analogs can also be employed to achieve different outcomes in synthetic processes. The choice of alternative reagents depends on the desired product, reaction conditions, and the overall efficiency of the synthesis.

About

CAS No 506-26-3
English Name (6Z,9Z,12Z)-6,9,12-Octadecatrienoic acid
Molecular Formula C18H30O2
Molecular Weight 278.44 g/mol
SMILES CCCCCC=CCC=CCC=CCCCCC(=O)O
InChIKey VZCCETWTMQHEPK-QNEBEIHSSA-N
Last Updated: 2025-09-11 18:29

Related Q&A

Compound Q&A

What regulatory guidelines apply to (6Z,9Z,12Z)-6,9,12-Octadecatrienoic acid (CAS: 506-26-3)?

The compound (6Z,9Z,12Z)-6,9,12-Octadecatrienoic acid (CAS: 506-26-3) is subject to various regulato...

Compound Q&A

What is the market or research trend for (6Z,9Z,12Z)-6,9,12-Octadecatrienoic acid (CAS: 506-26-3)?

The market and research trends for (6Z,9Z,12Z)-6,9,12-Octadecatrienoic acid (CAS: 506-26-3) are focu...

Compound Q&A

How should waste containing (6Z,9Z,12Z)-6,9,12-Octadecatrienoic acid (CAS: 506-26-3) be handled?

Waste containing (6Z,9Z,12Z)-6,9,12-Octadecatrienoic acid (CAS: 506-26-3) should be handled accordin...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...