Compound Q&A

How is Norethindrone acetate (CAS: 51-98-9) typically synthesized?

Answer

Norethindrone acetate
Norethindrone acetate (CAS: 51-98-9) is typically synthesized through a multi-step process starting from androstenedione or other steroid precursors. Common methods include acetylation reactions followed by various ring transformations and dehydrogenations. The synthesis often involves the use of catalysts and requires specific reaction conditions to achieve high selectivity and yield.

About

CAS No 51-98-9
English Name Norethindrone acetate
Molecular Formula C22H28O3
Molecular Weight 330.4680000000001 g/mol
SMILES CC(=O)OC1(CCC2C1(CCC3C2CCC4=CC(=O)CCC34)C)C#C
InChIKey PPVVBFLQFMBPFG-ZVZGYBOSSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of Norethindrone acetate (CAS: 51-98-9)?

Norethindrone acetate (CAS: 51-98-9) is a white to off-white crystalline powder. Its molecular weigh...

Compound Q&A

What industries use Norethindrone acetate (CAS: 51-98-9)?

Norethindrone acetate (CAS: 51-98-9) is primarily used in the pharmaceutical industry for hormonal c...

Compound Q&A

What precautions should be taken when handling Norethindrone acetate (CAS: 51-98-9)?

When handling Norethindrone acetate (CAS: 51-98-9), it is important to use personal protective equip...

Compound Q&A

How should 2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) be stored?

2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) should be stored in ...

615-45-22-Methylbenzene-1,4-...
Compound Q&A

Is (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide (CAS: 132747-20-7) safe?

(1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide is generally considered sa...

132747-20-7(1S,4S)-2,5-Diazabic...
Compound Q&A

What industries use (6-Chloropyridazin-3-YL)methanamine (CAS: 871826-15-2)?

(6-Chloropyridazin-3-YL)methanamine finds applications in the pharmaceutical ind...

871826-15-2(6-Chloropyridazin-3...
Compound Q&A

What are the main uses of 2-Fluoro-3-methylphenol (CAS: 77772-72-6)?

2-Fluoro-3-methylphenol is primarily used in the synthesis of pharmaceuticals, p...

77772-72-62-Fluoro-3-methylphe...