Compound Q&A

What are the physical and chemical properties of 1,2-Ethanediylbis[chloro(dimethyl)silane] (CAS: 13528-93-3)?

Answer

1,2-Ethanediylbis[chloro(dimethyl)silane]
1,2-Ethanediylbis[chloro(dimethyl)silane] (CAS: 13528-93-3) is a colorless or pale yellow liquid with a molecular weight of approximately 248.5 g/mol. It has a limited solubility in water but is soluble in organic solvents like ethanol and acetone. Chemically, it is reactive and can undergo hydrolysis and substitution reactions. It forms a crystalline solid at low temperatures.

About

CAS No 13528-93-3
English Name 1,2-Ethanediylbis[chloro(dimethyl)silane]
Molecular Formula C6H16Cl2Si2
Molecular Weight 215.27 g/mol
SMILES C[Si](C)(CC[Si](C)(C)Cl)Cl
InChIKey VGQOKOYKFDUPPJ-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

How is 1,2-Ethanediylbis[chloro(dimethyl)silane] (CAS: 13528-93-3) typically synthesized?

1,2-Ethanediylbis[chloro(dimethyl)silane] is typically synthesized by reacting chlorodimethylsilane ...

Compound Q&A

What industries use 1,2-Ethanediylbis[chloro(dimethyl)silane] (CAS: 13528-93-3)?

1,2-Ethanediylbis[chloro(dimethyl)silane] is used in various industries due to its chemical reactivi...

Compound Q&A

What precautions should be taken when handling 1,2-Ethanediylbis[chloro(dimethyl)silane] (CAS: 13528-93-3)?

When handling 1,2-Ethanediylbis[chloro(dimethyl)silane], it is crucial to wear appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...