Compound Q&A

What are the physical and chemical properties of 1,3-Diphenylguanidine hydrobromide (CAS: 93982-96-8)?

Answer

1,3-Diphenylguanidine hydrobromide
1,3-Diphenylguanidine hydrobromide (CAS: 93982-96-8) is a crystalline compound with a molecular weight of approximately 280.26 g/mol. It has a low solubility in water (0.7 g/L at 25°C) but is soluble in organic solvents like ethanol and methanol. The compound is reactive towards nucleophiles and can undergo substitution reactions. It is commonly used in the synthesis of other organic compounds due to its electrophilic functionality.

About

CAS No 93982-96-8
English Name 1,3-Diphenylguanidine hydrobromide
Molecular Formula C13H14BrN3
Molecular Weight 292.18 g/mol
SMILES C1=CC=C(C=C1)NC(=NC2=CC=CC=C2)N.Br
InChIKey DSESGJJGBBAHNW-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

How is 1,3-Diphenylguanidine hydrobromide (CAS: 93982-96-8) typically synthesized?

1,3-Diphenylguanidine hydrobromide (CAS: 93982-96-8) is typically synthesized by the reaction of 1,3...

Compound Q&A

What industries use 1,3-Diphenylguanidine hydrobromide (CAS: 93982-96-8)?

1,3-Diphenylguanidine hydrobromide (CAS: 93982-96-8) is used in various industries, including pharma...

Compound Q&A

What precautions should be taken when handling 1,3-Diphenylguanidine hydrobromide (CAS: 93982-96-8)?

When handling 1,3-Diphenylguanidine hydrobromide (CAS: 93982-96-8), it is important to use personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...