Compound Q&A

How is 4-Chloro-1-nitro-2-(trifluoromethyl)benzene (CAS: 118-83-2) typically synthesized?

Answer

4-Chloro-1-nitro-2-(trifluoromethyl)benzene
4-Chloro-1-nitro-2-(trifluoromethyl)benzene (CAS: 118-83-2) can be synthesized via the nitration of 4-chloro-2-(trifluoromethyl)benzene using concentrated nitric acid and sulfuric acid as the nitration reagents. The nitration typically occurs at low temperatures to control the reaction selectivity. The yield is generally high, and the product can be purified by recrystallization from an appropriate solvent.

About

CAS No 118-83-2
English Name 4-Chloro-1-nitro-2-(trifluoromethyl)benzene
Molecular Formula C7H3ClF3NO2
Molecular Weight 225.55 g/mol
SMILES C1=CC(=C(C=C1Cl)C(F)(F)F)[N+](=O)[O-]
InChIKey CFPIGEXZPWTNOR-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Chloro-1-nitro-2-(trifluoromethyl)benzene (CAS: 118-83-2)?

4-Chloro-1-nitro-2-(trifluoromethyl)benzene (CAS: 118-83-2) is a crystalline solid with a molecular ...

Compound Q&A

What industries use 4-Chloro-1-nitro-2-(trifluoromethyl)benzene (CAS: 118-83-2)?

4-Chloro-1-nitro-2-(trifluoromethyl)benzene (CAS: 118-83-2) is used in the pharmaceutical industry a...

Compound Q&A

What precautions should be taken when handling 4-Chloro-1-nitro-2-(trifluoromethyl)benzene (CAS: 118-83-2)?

When handling 4-Chloro-1-nitro-2-(trifluoromethyl)benzene (CAS: 118-83-2), it is crucial to wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...