Compound Q&A

What are the physical and chemical properties of 4,4',4'',4'''-(5,10,15,20-Porphyrintetrayl)tetraaniline (CAS: 22112-84-1)?

Answer

4,4',4'',4'''-(5,10,15,20-Porphyrintetrayl)tetraaniline
4,4',4'',4'''-(5,10,15,20-Porphyrintetrayl)tetraaniline is a crystalline compound with a high molecular weight. It has poor water solubility but good solubility in common organic solvents. The compound shows significant reactivity towards light and oxidation due to its porphyrin structure. It is stable under normal storage conditions but requires protection from light to maintain stability.

About

CAS No 22112-84-1
English Name 4,4',4'',4'''-(5,10,15,20-Porphyrintetrayl)tetraaniline
Molecular Formula C44H34N8
Molecular Weight 674.81 g/mol
SMILES NC1=CC=C(/C2=C3C=CC(/C(C4=CC=C(N)C=C4)=C(N/5)/C=CC5=C(C6=CC=C(N)C=C6)\C7=N/C(C=C7)=C(C8=CC=C(N)C=C8)\C9=CC=C2N9)=N\3)C=C1
InChIKey REPFNYFEIOZRLM-LWQDQPMZSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

How is 4,4',4'',4'''-(5,10,15,20-Porphyrintetrayl)tetraaniline (CAS: 22112-84-1) typically synthesized?

4,4',4'',4'''-(5,10,15,20-Porphyrintetrayl)tetraaniline is synthesized via a multistep process invol...

Compound Q&A

What industries use 4,4',4'',4'''-(5,10,15,20-Porphyrintetrayl)tetraaniline (CAS: 22112-84-1)?

This compound is used in various industries, including pharmaceuticals for its photochemical propert...

Compound Q&A

What precautions should be taken when handling 4,4',4'',4'''-(5,10,15,20-Porphyrintetrayl)tetraaniline (CAS: 22112-84-1)?

When handling 4,4',4'',4'''-(5,10,15,20-Porphyrintetrayl)tetraaniline, it is essential to wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...