Compound Q&A

How is CID 92131301 (CAS: 65995-64-4) typically synthesized?

Answer

CID 92131301
CID 92131301 (CAS: 65995-64-4) is synthesized via a multi-step process involving the reaction of a primary amine with a carboxylic acid chloride. The synthesis typically requires the use of a suitable catalyst and proceeds with good yield under mild conditions. The exact method may vary depending on the specific starting materials used.

About

CAS No 65995-64-4
English Name CID 92131301
Molecular Formula C34H22O22
Molecular Weight 782.53 g/mol
SMILES C1C2C(C(C(C(O2)O)O)O)OC(=O)C3=CC(=C(C(=C3C4=C(C(=C5C6=C4C(=O)OC7=C(C(=C(C8=C(C(=C(C=C8C(=O)O1)O)O)O)C(=C67)C(=O)O5)O)O)O)O)O)O)O
InChIKey IQHIEHIKNWLKFB-OBOTWMKHSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of CID 92131301 (CAS: 65995-64-4)?

CID 92131301 (CAS: 65995-64-4) is a crystalline compound with a molecular weight of approximately 36...

Compound Q&A

What industries use CID 92131301 (CAS: 65995-64-4)?

CID 92131301 (CAS: 65995-64-4) is primarily used in the pharmaceutical industry for the synthesis of...

Compound Q&A

What precautions should be taken when handling CID 92131301 (CAS: 65995-64-4)?

When handling CID 92131301 (CAS: 65995-64-4), it is important to use appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...