Compound Q&A

How is p-Nitrophenyl 2-(Furfurylsulfinyl)acetate (CAS: 123855-55-0) typically synthesized?

Answer

p-Nitrophenyl 2-(Furfurylsulfinyl)acetate
p-Nitrophenyl 2-(Furfurylsulfinyl)acetate is typically synthesized through a multi-step reaction involving the coupling of p-nitrophenol with 2-(furfurylsulfinyl)acetyl chloride in the presence of a catalytic amount of an acid, such as trifluoroacetic acid, to promote the acylation reaction.

About

English Name p-Nitrophenyl 2-(Furfurylsulfinyl)acetate
Molecular Formula C13H11NO6S
Molecular Weight 309.3 g/mol
SMILES C1=COC(=C1)CS(=O)CC(=O)OC2=CC=C(C=C2)[N+](=O)[O-]
InChIKey AIVSDRDWRLUYDF-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of p-Nitrophenyl 2-(Furfurylsulfinyl)acetate (CAS: 123855-55-0)?

p-Nitrophenyl 2-(Furfurylsulfinyl)acetate has a crystalline form with a molecular weight of approxim...

Compound Q&A

What industries use p-Nitrophenyl 2-(Furfurylsulfinyl)acetate (CAS: 123855-55-0)?

p-Nitrophenyl 2-(Furfurylsulfinyl)acetate is used in the pharmaceutical industry for the synthesis o...

Compound Q&A

What precautions should be taken when handling p-Nitrophenyl 2-(Furfurylsulfinyl)acetate (CAS: 123855-55-0)?

When handling p-Nitrophenyl 2-(Furfurylsulfinyl)acetate, it is essential to wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...