Compound Q&A

How is Methyl 4-amino-5-(ethylsulfonyl)-2-methoxybenzoate (CAS: 80036-89-1) typically synthesized?

Answer

Methyl 4-amino-5-(ethylsulfonyl)-2-methoxybenzoate
Methyl 4-amino-5-(ethylsulfonyl)-2-methoxybenzoate is usually synthesized via a multi-step process involving the condensation of 4-amino-5-(ethylsulfonyl)-2-methoxybenzoic acid with methyl alcohol. The reaction typically requires a suitable base as a catalyst, and high yield can be achieved with appropriate conditions. The synthetic route is selective and efficient, producing a high purity product.

About

CAS No 80036-89-1
English Name Methyl 4-amino-5-(ethylsulfonyl)-2-methoxybenzoate
Molecular Formula C11H15NO5S
Molecular Weight 273.31 g/mol
SMILES CCS(=O)(=O)C1=C(C=C(C(=C1)C(=O)OC)OC)N
InChIKey BBWJVKZAKHIKRQ-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 4-amino-5-(ethylsulfonyl)-2-methoxybenzoate (CAS: 80036-89-1)?

Methyl 4-amino-5-(ethylsulfonyl)-2-methoxybenzoate is a crystalline compound with a molecular weight...

Compound Q&A

What industries use Methyl 4-amino-5-(ethylsulfonyl)-2-methoxybenzoate (CAS: 80036-89-1)?

Methyl 4-amino-5-(ethylsulfonyl)-2-methoxybenzoate is used in various industries, particularly in ph...

Compound Q&A

What precautions should be taken when handling Methyl 4-amino-5-(ethylsulfonyl)-2-methoxybenzoate (CAS: 80036-89-1)?

Precautions when handling Methyl 4-amino-5-(ethylsulfonyl)-2-methoxybenzoate include wearing appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...