Compound Q&A

How is 2-Bromo-1-methyl-4-nitrobenzene (CAS: 7745-93-9) typically synthesized?

Answer

2-Bromo-1-methyl-4-nitrobenzene
2-Bromo-1-methyl-4-nitrobenzene is typically synthesized through the bromination of 1-methyl-4-nitrobenzene using bromine in the presence of a Lewis acid like aluminum bromide. This process involves the electrophilic aromatic substitution of bromine at the meta position, followed by the introduction of the methyl group. The yield is usually good, and the selectivity is high for this position.

About

CAS No 7745-93-9
English Name 2-Bromo-1-methyl-4-nitrobenzene
Molecular Formula C7H6BrNO2
Molecular Weight 216.03 g/mol
SMILES CC1=C(C=C(C=C1)[N+](=O)[O-])Br
InChIKey XFZFJQHXWJIBQV-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Bromo-1-methyl-4-nitrobenzene (CAS: 7745-93-9)?

2-Bromo-1-methyl-4-nitrobenzene is a crystalline solid with a molecular weight of approximately 222....

Compound Q&A

What industries use 2-Bromo-1-methyl-4-nitrobenzene (CAS: 7745-93-9)?

2-Bromo-1-methyl-4-nitrobenzene is used in various industries. It is a key intermediate in the produ...

Compound Q&A

What precautions should be taken when handling 2-Bromo-1-methyl-4-nitrobenzene (CAS: 7745-93-9)?

When handling 2-bromo-1-methyl-4-nitrobenzene, it is essential to wear personal protective equipment...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...