Compound Q&A

What are the physical and chemical properties of Isopropyl (2E,4E)-11-methoxy-3,7,11-trimethyl-2,4-dodecadienoate (CAS: 40596-69-8)?

Answer

Isopropyl (2E,4E)-11-methoxy-3,7,11-trimethyl-2,4-dodecadienoate
Isopropyl (2E,4E)-11-methoxy-3,7,11-trimethyl-2,4-dodecadienoate is a colorless liquid with a molecular weight of approximately 282.42 g/mol. It has a high solubility in organic solvents like ethanol and poor solubility in water. Chemically, it is relatively stable but can react with strong oxidizing agents. It has a distinctive odor and is used as a fragrance and chemical intermediate.

About

CAS No 40596-69-8
English Name Isopropyl (2E,4E)-11-methoxy-3,7,11-trimethyl-2,4-dodecadienoate
Molecular Formula C19H34O3
Molecular Weight 310.48 g/mol
SMILES CC(C)(OC)CCCC(C)C/C=C/C(C)=C/C(OC(C)C)=O
InChIKey NFGXHKASABOEEW-LDRANXPESA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

How is Isopropyl (2E,4E)-11-methoxy-3,7,11-trimethyl-2,4-dodecadienoate (CAS: 40596-69-8) typically synthesized?

Isopropyl (2E,4E)-11-methoxy-3,7,11-trimethyl-2,4-dodecadienoate is synthesized through a series of ...

Compound Q&A

What industries use Isopropyl (2E,4E)-11-methoxy-3,7,11-trimethyl-2,4-dodecadienoate (CAS: 40596-69-8)?

Isopropyl (2E,4E)-11-methoxy-3,7,11-trimethyl-2,4-dodecadienoate is primarily used in the fragrance ...

Compound Q&A

What precautions should be taken when handling Isopropyl (2E,4E)-11-methoxy-3,7,11-trimethyl-2,4-dodecadienoate (CAS: 40596-69-8)?

When handling Isopropyl (2E,4E)-11-methoxy-3,7,11-trimethyl-2,4-dodecadienoate, it is crucial to use...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...