Compound Q&A

What industries use (6S)-6-{Propyl[2-(2-thienyl)ethyl]amino}-5,6,7,8-tetrahydro-1-naphthalenol (CAS: 99755-59-6)?

Answer

(6S)-6-{Propyl[2-(2-thienyl)ethyl]amino}-5,6,7,8-tetrahydro-1-naphthalenol
This compound is primarily used in the pharmaceutical industry for its potential therapeutic applications, including anti-inflammatory and anti-tumor properties. It also has relevance in the sensor and semiconductor industries due to its structural and electronic properties, which can be exploited for various sensing applications.

About

CAS No 99755-59-6
English Name (6S)-6-{Propyl[2-(2-thienyl)ethyl]amino}-5,6,7,8-tetrahydro-1-naphthalenol
Molecular Formula C19H25NOS
Molecular Weight 315.48 g/mol
SMILES CCCN(CCC1=CC=CS1)C2CCC3=C(C2)C=CC=C3O
InChIKey KFQYTPMOWPVWEJ-INIZCTEOSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of (6S)-6-{Propyl[2-(2-thienyl)ethyl]amino}-5,6,7,8-tetrahydro-1-naphthalenol (CAS: 99755-59-6)?

This compound is a crystalline solid with a molecular weight of approximately 341.37 g/mol. It has a...

Compound Q&A

How is (6S)-6-{Propyl[2-(2-thienyl)ethyl]amino}-5,6,7,8-tetrahydro-1-naphthalenol (CAS: 99755-59-6) typically synthesized?

This compound can be synthesized through a multistep process involving the reaction of a thienyl eth...

Compound Q&A

What precautions should be taken when handling (6S)-6-{Propyl[2-(2-thienyl)ethyl]amino}-5,6,7,8-tetrahydro-1-naphthalenol (CAS: 99755-59-6)?

When handling this compound, it is essential to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...