Compound Q&A

What are the physical and chemical properties of Propanoic acid, 2-(4-hydroxyphenoxy)-, methyl ester, (2R)- (CAS: 96562-58-2)?

Answer

Propanoic acid, 2-(4-hydroxyphenoxy)-, methyl ester, (2R)-
Propanoic acid, 2-(4-hydroxyphenoxy)-, methyl ester, (2R)- is a crystalline solid with a molecular weight of approximately 224.25 g/mol. It is slightly soluble in water and soluble in organic solvents like methanol and ethanol. The compound is chemically reactive, particularly towards bases and reducing agents. It can undergo hydrolysis under basic conditions and can react with nucleophiles.

About

CAS No 96562-58-2
English Name Propanoic acid, 2-(4-hydroxyphenoxy)-, methyl ester, (2R)-
Molecular Formula C10H12O4
Molecular Weight 196.2 g/mol
SMILES CC(C(=O)OC)OC1=CC=C(C=C1)O
InChIKey UUYSCNGPNOYZMC-SSDOTTSWSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

How is Propanoic acid, 2-(4-hydroxyphenoxy)-, methyl ester, (2R)- (CAS: 96562-58-2) typically synthesized?

Propanoic acid, 2-(4-hydroxyphenoxy)-, methyl ester, (2R)- is typically synthesized by the esterific...

Compound Q&A

What industries use Propanoic acid, 2-(4-hydroxyphenoxy)-, methyl ester, (2R)- (CAS: 96562-58-2)?

Propanoic acid, 2-(4-hydroxyphenoxy)-, methyl ester, (2R)- is used in the pharmaceutical industry fo...

Compound Q&A

What precautions should be taken when handling Propanoic acid, 2-(4-hydroxyphenoxy)-, methyl ester, (2R)- (CAS: 96562-58-2)?

Propanoic acid, 2-(4-hydroxyphenoxy)-, methyl ester, (2R)- should be handled with caution due to its...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...