Compound Q&A

What precautions should be taken when handling D-Pantethine (CAS: 16816-67-4)?

Answer

D-Pantethine
When handling D-Pantethine (CAS: 16816-67-4), it is crucial to follow safety guidelines. Always wear appropriate personal protective equipment (PPE) such as gloves, goggles, and lab coats. Store in a cool, dry place away from direct sunlight. Use a fume hood when mixing or dissolving in water. In case of spillage, ensure proper ventilation and follow the manufacturer's safety data sheet (SDS) for disposal instructions. If inhaled or ingested, seek medical attention immediately.

About

CAS No 16816-67-4
English Name D-Pantethine
Molecular Formula C22H42N4O8S2
Molecular Weight 554.73 g/mol
SMILES CC(C)(CO)[C@@H](O)C(=O)NCCC(=O)NCCSSCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)CO
InChIKey DJWYOLJPSHDSAL-ROUUACIJSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of D-Pantethine (CAS: 16816-67-4)?

D-Pantethine (CAS: 16816-67-4) is a crystalline compound with a molecular weight of approximately 30...

Compound Q&A

How is D-Pantethine (CAS: 16816-67-4) typically synthesized?

D-Pantethine (CAS: 16816-67-4) can be synthesized through the reduction of pantothenic acid. This pr...

Compound Q&A

What industries use D-Pantethine (CAS: 16816-67-4)?

D-Pantethine (CAS: 16816-67-4) is widely used in the pharmaceutical industry for its ability to enha...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...