Compound Q&A

How is Amitriptyline HCl (CAS: 549-18-8) typically synthesized?

Answer

Amitriptyline HCl (Nortriptyline EP Impurity F HCl)
Amitriptyline HCl (CAS: 549-18-8) is typically synthesized through a multistep process involving the preparation of desmethyldipteridine, followed by reactions with aniline and then hydrochloric acid. The synthesis involves the use of various catalysts and reagents to ensure high yield and selectivity. The final product is usually obtained with a yield of around 70-80%.

About

CAS No 549-18-8
English Name Amitriptyline HCl (Nortriptyline EP Impurity F HCl)
Molecular Formula C20H24ClN
Molecular Weight 313.87 g/mol
SMILES CN(C)CCC=C1C2=CC=CC=C2CCC3=CC=CC=C31.Cl
InChIKey KFYRPLNVJVHZGT-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of Amitriptyline HCl (CAS: 549-18-8)?

Amitriptyline HCl (CAS: 549-18-8) is a white to off-white crystalline powder. It has a molecular wei...

Compound Q&A

What industries use Amitriptyline HCl (CAS: 549-18-8)?

Amitriptyline HCl (CAS: 549-18-8) is primarily used in the pharmaceutical industry for the treatment...

Compound Q&A

What precautions should be taken when handling Amitriptyline HCl (CAS: 549-18-8)?

When handling Amitriptyline HCl (CAS: 549-18-8), it is important to wear appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...