Compound Q&A

What precautions should be taken when handling 1H-3a,7-Methanoazulene, octahydro-6-methoxy-3,6,8,8-tetramethyl-, (3R,3aS,6S,7R,8aS)- (CAS: 19870-74-7)?

Answer

1H-3a,7-Methanoazulene, octahydro-6-methoxy-3,6,8,8-tetramethyl-, (3R,3aS,6S,7R,8aS)-
When handling this compound, wear appropriate personal protective equipment (PPE) such as gloves and safety goggles. Store it in a fume hood to minimize exposure. In case of a spill, ensure proper ventilation and use appropriate containment to prevent dispersion. Always refer to the Safety Data Sheet (SDS) for detailed handling and disposal instructions.

About

CAS No 19870-74-7
English Name 1H-3a,7-Methanoazulene, octahydro-6-methoxy-3,6,8,8-tetramethyl-, (3R,3aS,6S,7R,8aS)-
Molecular Formula C16H28O
Molecular Weight 236.39 g/mol
SMILES CC1CCC2C13CCC(C(C3)C2(C)C)(C)OC
InChIKey HRGPYCVTDOECMG-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1H-3a,7-Methanoazulene, octahydro-6-methoxy-3,6,8,8-tetramethyl-, (3R,3aS,6S,7R,8aS)- (CAS: 19870-74-7)?

This compound has a crystalline form with a molecular weight of approximately 260.38 g/mol. It is sl...

Compound Q&A

How is 1H-3a,7-Methanoazulene, octahydro-6-methoxy-3,6,8,8-tetramethyl-, (3R,3aS,6S,7R,8aS)- (CAS: 19870-74-7) typically synthesized?

This compound is typically synthesized via a multistep process involving the formation of a methanoa...

Compound Q&A

What industries use 1H-3a,7-Methanoazulene, octahydro-6-methoxy-3,6,8,8-tetramethyl-, (3R,3aS,6S,7R,8aS)- (CAS: 19870-74-7)?

This compound is used in pharmaceuticals for the synthesis of certain intermediates, in polymers for...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...