Compound Q&A

What are the physical and chemical properties of Disodium 3,3'-carbonylbis(4-hydroxy-6-methoxybenzenesulfonate) (CAS: 76656-36-5)?

Answer

Disodium 3,3'-carbonylbis(4-hydroxy-6-methoxybenzenesulfonate)
Disodium 3,3'-carbonylbis(4-hydroxy-6-methoxybenzenesulfonate) is a white to off-white crystalline solid with a molecular weight of approximately 511.24 g/mol. It has a high melting point and is poorly soluble in water but soluble in organic solvents. This compound is known for its reactivity in nucleophilic substitution reactions and can form complexes with metal ions.

About

CAS No 76656-36-5
English Name Disodium 3,3'-carbonylbis(4-hydroxy-6-methoxybenzenesulfonate)
Molecular Formula C15H12Na2O11S2
Molecular Weight 478.4 g/mol
SMILES COC1=C(C=C(C(=C1)O)C(=O)C2=CC(=C(C=C2O)OC)S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+]
InChIKey QDCHWIWENYCPIL-UHFFFAOYSA-L
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

How is Disodium 3,3'-carbonylbis(4-hydroxy-6-methoxybenzenesulfonate) (CAS: 76656-36-5) typically synthesized?

Disodium 3,3'-carbonylbis(4-hydroxy-6-methoxybenzenesulfonate) is synthesized by the condensation of...

Compound Q&A

What industries use Disodium 3,3'-carbonylbis(4-hydroxy-6-methoxybenzenesulfonate) (CAS: 76656-36-5)?

Disodium 3,3'-carbonylbis(4-hydroxy-6-methoxybenzenesulfonate) is used in pharmaceutical application...

Compound Q&A

What precautions should be taken when handling Disodium 3,3'-carbonylbis(4-hydroxy-6-methoxybenzenesulfonate) (CAS: 76656-36-5)?

When handling Disodium 3,3'-carbonylbis(4-hydroxy-6-methoxybenzenesulfonate), ensure the use of appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...