Compound Q&A

What industries use 1,6-Hexanediylbis(diphenylphosphine) (CAS: 19845-69-3)?

Answer

1,6-Hexanediylbis(diphenylphosphine)
1,6-Hexanediylbis(diphenylphosphine) is used in various industries, including pharmaceuticals, where it serves as a ligand in metal complexes. It is also utilized in polymer science for modifying properties of polymers and in the semiconductor industry for its use as a dopant. Additionally, it has applications in sensors due to its reactivity and ability to form stable complexes with metal ions.

About

CAS No 19845-69-3
English Name 1,6-Hexanediylbis(diphenylphosphine)
Molecular Formula C30H32P2
Molecular Weight 454.53 g/mol
SMILES C1=CC=C(C=C1)P(CCCCCCP(C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4
InChIKey GPORFKPYXATYNX-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,6-Hexanediylbis(diphenylphosphine) (CAS: 19845-69-3)?

1,6-Hexanediylbis(diphenylphosphine) is a colorless solid that is crystalline at room temperature. I...

Compound Q&A

How is 1,6-Hexanediylbis(diphenylphosphine) (CAS: 19845-69-3) typically synthesized?

1,6-Hexanediylbis(diphenylphosphine) is synthesized through a multi-step process involving the react...

Compound Q&A

What precautions should be taken when handling 1,6-Hexanediylbis(diphenylphosphine) (CAS: 19845-69-3)?

When handling 1,6-Hexanediylbis(diphenylphosphine), it is essential to use appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...