Compound Q&A

What are the physical and chemical properties of 1,3-Benzodioxol-5-ylacetic acid (CAS: 2861-28-1)?

Answer

1,3-Benzodioxol-5-ylacetic acid
1,3-Benzodioxol-5-ylacetic acid has a white or off-white crystalline form. Its molecular weight is approximately 184.17 g/mol. The compound is slightly soluble in water but soluble in common organic solvents like acetone and dimethylformamide. It is moderately reactive, particularly with strong bases and reducing agents. Accurate pH measurements show that it has a pKa value around 4.1.

About

CAS No 2861-28-1
English Name 1,3-Benzodioxol-5-ylacetic acid
Molecular Formula C9H8O4
Molecular Weight 180.16 g/mol
SMILES C1OC2=C(O1)C=C(C=C2)CC(=O)O
InChIKey ODVLMCWNGKLROU-UHFFFAOYSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

How is 1,3-Benzodioxol-5-ylacetic acid (CAS: 2861-28-1) typically synthesized?

1,3-Benzodioxol-5-ylacetic acid can be synthesized via a multi-step process starting from 1,3-benzen...

Compound Q&A

What industries use 1,3-Benzodioxol-5-ylacetic acid (CAS: 2861-28-1)?

1,3-Benzodioxol-5-ylacetic acid is primarily used in the pharmaceutical industry for the synthesis o...

Compound Q&A

What precautions should be taken when handling 1,3-Benzodioxol-5-ylacetic acid (CAS: 2861-28-1)?

When handling 1,3-Benzodioxol-5-ylacetic acid, it is important to use appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...