Compound Q&A

What industries use Ethyl (S)-2-amino-4-phenylbutanoate hydrochloride (CAS: 90891-21-7)?

Answer

Ethyl (S)-2-amino-4-phenylbutanoate hydrochloride
Ethyl (S)-2-amino-4-phenylbutanoate hydrochloride is primarily used in the pharmaceutical industry for the synthesis of various drugs. It is also applied in the production of certain polymers and as a chiral auxiliary in the synthesis of chiral compounds. Additionally, it can be used in the development of sensors and in semiconductor applications.

About

CAS No 90891-21-7
English Name Ethyl (S)-2-amino-4-phenylbutanoate hydrochloride
Molecular Formula C12H18ClNO2
Molecular Weight 243.73399999999998 g/mol
SMILES CCOC(=O)C(CCC1=CC=CC=C1)N.Cl
InChIKey PTFKZMFFSIYCOV-MERQFXBCSA-N
Last Updated: 2025-09-10 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl (S)-2-amino-4-phenylbutanoate hydrochloride (CAS: 90891-21-7)?

Ethyl (S)-2-amino-4-phenylbutanoate hydrochloride is a colorless to white crystalline solid with a m...

Compound Q&A

How is Ethyl (S)-2-amino-4-phenylbutanoate hydrochloride (CAS: 90891-21-7) typically synthesized?

Ethyl (S)-2-amino-4-phenylbutanoate hydrochloride can be synthesized via the reaction of ethyl 4-ami...

Compound Q&A

What precautions should be taken when handling Ethyl (S)-2-amino-4-phenylbutanoate hydrochloride (CAS: 90891-21-7)?

When handling Ethyl (S)-2-amino-4-phenylbutanoate hydrochloride, proper personal protective equipmen...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...