Compound Q&A

How is [1-Hydroxy-2-(1H-imidazol-1-yl)-1,1-ethanediyl]bis(phosphonic acid) hydrate (CAS: 165800-06-6) typically synthesized?

Answer

[1-Hydroxy-2-(1H-imidazol-1-yl)-1,1-ethanediyl]bis(phosphonic acid) hydrate (1:1)
This compound is typically synthesized through a multi-step process involving the reaction of imidazole with phosphonic acid. The synthesis involves the formation of a phosphonimidazolyl intermediate, followed by further reactions to form the hydrate. The exact conditions, such as temperature and pressure, can vary depending on the specific method used.

About

English Name [1-Hydroxy-2-(1H-imidazol-1-yl)-1,1-ethanediyl]bis(phosphonic acid) hydrate (1:1)
Molecular Formula C5H12N2O8P2
Molecular Weight 290.1 g/mol
SMILES O.OC(Cn1ccnc1)(P(=O)(O)O)P(=O)(O)O
InChIKey FUXFIVRTGHOMSO-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of [1-Hydroxy-2-(1H-imidazol-1-yl)-1,1-ethanediyl]bis(phosphonic acid) hydrate (CAS: 165800-06-6)?

This compound is a hydrate of bis(phosphonic acid) with a crystalline form. The molecular weight is ...

Compound Q&A

What industries use [1-Hydroxy-2-(1H-imidazol-1-yl)-1,1-ethanediyl]bis(phosphonic acid) hydrate (CAS: 165800-06-6)?

This compound finds applications in various industries due to its unique properties. It is used in p...

Compound Q&A

What precautions should be taken when handling [1-Hydroxy-2-(1H-imidazol-1-yl)-1,1-ethanediyl]bis(phosphonic acid) hydrate (CAS: 165800-06-6)?

When handling this compound, it is important to use personal protective equipment (PPE) such as glov...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...