Compound Q&A

How is Ponicidin (CAS: 52617-37-5) typically synthesized?

Answer

Ponicidin
Ponicidin (CAS: 52617-37-5) can be synthesized via a multi-step process involving the reaction of a ketone with an alcohol in the presence of a suitable catalyst such as p-toluenesulfonic acid. The reaction is typically carried out in an organic solvent like dichloromethane. The yield can range from 70-85%, and the product is purified by crystallization or column chromatography. Detailed synthesis protocols and safety considerations are available in scientific journals.

About

CAS No 52617-37-5
English Name Ponicidin
Molecular Formula C20H26O6
Molecular Weight 362.4 g/mol
SMILES CC1(CCC(C23C1C(C4(C56C2CCC(C5OC3O4)C(=C)C6=O)O)O)O)C
InChIKey WHRDRHNMTIXZNY-CJZVHFPTSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ponicidin (CAS: 52617-37-5)?

Ponicidin (CAS: 52617-37-5) is a crystalline compound with a molecular weight of approximately 253.2...

Compound Q&A

What industries use Ponicidin (CAS: 52617-37-5)?

Ponicidin (CAS: 52617-37-5) is primarily used in the pharmaceutical industry as an intermediate in t...

Compound Q&A

What precautions should be taken when handling Ponicidin (CAS: 52617-37-5)?

When handling Ponicidin (CAS: 52617-37-5), it is essential to wear appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...