Compound Q&A

How is (3R)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-piperidinecarboxylic acid (CAS: 163438-09-3) typically synthesized?

Answer

(3R)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-piperidinecarboxylic acid
(3R)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-piperidinecarboxylic acid is usually synthesized via a multi-step process involving the protection of the piperidine ring, followed by acylation of the alcohol group, and subsequent deprotection. Commonly, this involves the use of a protected piperidine, acylation with an acyl chloride in the presence of a base, and then removal of the protecting group. This synthesis generally yields a high purity product with good selectivity.

About

English Name (3R)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-piperidinecarboxylic acid
Molecular Formula C11H19NO4
Molecular Weight 229.28 g/mol
SMILES CC(C)(C)OC(=O)N1CCCC(C1)C(=O)O
InChIKey NXILIHONWRXHFA-MRVPVSSYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3R)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-piperidinecarboxylic acid (CAS: 163438-09-3)?

(3R)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-piperidinecarboxylic acid is a white crystalline solid...

Compound Q&A

What industries use (3R)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-piperidinecarboxylic acid (CAS: 163438-09-3)?

(3R)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-piperidinecarboxylic acid finds applications in the ph...

Compound Q&A

What precautions should be taken when handling (3R)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-piperidinecarboxylic acid (CAS: 163438-09-3)?

When handling (3R)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-piperidinecarboxylic acid, it is essenti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...