Compound Q&A

What industries use 2-Chloro-5-nitrobenzaldehyde (CAS: 6361-21-3)?

Answer

2-Chloro-5-nitrobenzaldehyde
2-Chloro-5-nitrobenzaldehyde is utilized in pharmaceuticals, where it serves as an intermediate in the production of certain drugs. It is also used in the synthesis of dyes, polymers, and sensors due to its functional groups. Its reactivity makes it valuable in semiconductor manufacturing as well.

About

CAS No 6361-21-3
English Name 2-Chloro-5-nitrobenzaldehyde
Molecular Formula C7H4ClNO3
Molecular Weight 185.56 g/mol
SMILES C1=CC(=C(C=C1[N+](=O)[O-])C=O)Cl
InChIKey VFVHWCKUHAEDMY-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Chloro-5-nitrobenzaldehyde (CAS: 6361-21-3)?

2-Chloro-5-nitrobenzaldehyde is a yellow to orange crystalline solid with a molecular weight of 211....

Compound Q&A

How is 2-Chloro-5-nitrobenzaldehyde (CAS: 6361-21-3) typically synthesized?

2-Chloro-5-nitrobenzaldehyde is typically synthesized via the nitration of 2-chlorobenzaldehyde foll...

Compound Q&A

What precautions should be taken when handling 2-Chloro-5-nitrobenzaldehyde (CAS: 6361-21-3)?

When handling 2-Chloro-5-nitrobenzaldehyde, it is essential to wear appropriate personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...