Compound Q&A

What are the physical and chemical properties of 1-Bromo-4-(trans-4-propylcyclohexyl)benzene (CAS: 86579-53-5)?

Answer

1-Bromo-4-(trans-4-propylcyclohexyl)benzene
1-Bromo-4-(trans-4-propylcyclohexyl)benzene (CAS: 86579-53-5) is a crystalline solid with a molecular weight of approximately 284.16 g/mol. This compound has limited solubility in water but is more soluble in organic solvents such as ethanol and dichloromethane. Chemically, it shows moderate reactivity, particularly in nucleophilic substitution reactions. It is less reactive compared to primary and secondary bromides but can undergo reactions with strong bases and amines.

About

CAS No 86579-53-5
English Name 1-Bromo-4-(trans-4-propylcyclohexyl)benzene
Molecular Formula C15H21Br
Molecular Weight 281.2370000000001 g/mol
SMILES CCC[C@H]1CC[C@H](C2=CC=C(Br)C=C2)CC1
InChIKey GMZABADCQVWQPS-JOCQHMNTSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

How is 1-Bromo-4-(trans-4-propylcyclohexyl)benzene (CAS: 86579-53-5) typically synthesized?

1-Bromo-4-(trans-4-propylcyclohexyl)benzene is typically synthesized via a bromination reaction of 4...

Compound Q&A

What industries use 1-Bromo-4-(trans-4-propylcyclohexyl)benzene (CAS: 86579-53-5)?

1-Bromo-4-(trans-4-propylcyclohexyl)benzene (CAS: 86579-53-5) is used in various industries, particu...

Compound Q&A

What precautions should be taken when handling 1-Bromo-4-(trans-4-propylcyclohexyl)benzene (CAS: 86579-53-5)?

When handling 1-Bromo-4-(trans-4-propylcyclohexyl)benzene (CAS: 86579-53-5), it is essential to wear...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...