Compound Q&A

How is Polypropylenglycol diglycidyl ether (CAS: 26142-30-3) typically synthesized?

Answer

Polypropylenglycol diglycidyl ether
Polypropylenglycol diglycidyl ether (CAS: 26142-30-3) is synthesized by reacting propylene glycol with epichlorohydrin in the presence of a strong acid catalyst, such as sulfuric acid. The reaction produces a product with a high epoxy equivalent, which can be used for various applications, including coatings, adhesives, and composites.

About

CAS No 26142-30-3
English Name Polypropylenglycol diglycidyl ether
Molecular Formula (C3H6O)N.C6H10O3
Molecular Weight 0 g/mol
SMILES O1C(COCCCOCC2OC2)C1.O1C(COCCCOCC2OC2)C1
InChIKey LWPNHGSIDMVCIQ-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Polypropylenglycol diglycidyl ether (CAS: 26142-30-3)?

Polypropylenglycol diglycidyl ether (CAS: 26142-30-3) is a colorless to light yellow liquid with a m...

Compound Q&A

What industries use Polypropylenglycol diglycidyl ether (CAS: 26142-30-3)?

Polypropylenglycol diglycidyl ether (CAS: 26142-30-3) is widely used in the coatings and adhesives i...

Compound Q&A

What precautions should be taken when handling Polypropylenglycol diglycidyl ether (CAS: 26142-30-3)?

When handling Polypropylenglycol diglycidyl ether (CAS: 26142-30-3), it is essential to wear appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...