Compound Q&A

What industries use 2-(Chlorocarbonyl)phenyl acetate (CAS: 5538-51-2)?

Answer

2-(Chlorocarbonyl)phenyl acetate
2-(Chlorocarbonyl)phenyl acetate (CAS: 5538-51-2) finds applications in the pharmaceutical industry for the synthesis of certain intermediates and in the polymer industry as a monomer or additive. It is also used in the production of sensors and semiconductors due to its chemical reactivity and stability.

About

CAS No 5538-51-2
English Name 2-(Chlorocarbonyl)phenyl acetate
Molecular Formula C9H7ClO3
Molecular Weight 198.6 g/mol
SMILES CC(=O)OC1=CC=CC=C1C(=O)Cl
InChIKey DSGKWFGEUBCEIE-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(Chlorocarbonyl)phenyl acetate (CAS: 5538-51-2)?

2-(Chlorocarbonyl)phenyl acetate (CAS: 5538-51-2) is a white crystalline solid with a molecular weig...

Compound Q&A

How is 2-(Chlorocarbonyl)phenyl acetate (CAS: 5538-51-2) typically synthesized?

2-(Chlorocarbonyl)phenyl acetate is typically synthesized by reacting phenyl acetate with thionyl ch...

Compound Q&A

What precautions should be taken when handling 2-(Chlorocarbonyl)phenyl acetate (CAS: 5538-51-2)?

When handling 2-(Chlorocarbonyl)phenyl acetate (CAS: 5538-51-2), it is essential to use personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...