Compound Q&A

What are the physical and chemical properties of Nandrolone (CAS: 434-22-0)?

Answer

Nandrolone
Nandrolone (CAS: 434-22-0) is a crystalline compound with a molecular weight of approximately 224.21 g/mol. It has a melting point of 129-131°C and is only slightly soluble in water but soluble in organic solvents such as ethanol and acetone. Nandrolone is relatively stable under normal conditions but is prone to oxidation and hydrolysis, especially in the presence of moisture and light.

About

CAS No 434-22-0
English Name Nandrolone
Molecular Formula C18H26O2
Molecular Weight 274.4 g/mol
SMILES O([H])[C@@]1([H])C([H])([H])C([H])([H])[C@@]2([H])[C@]3([H])C([H])([H])C([H])([H])C4=C([H])C(C([H])([H])C([H])([H])[C@]4([H])[C@@]3([H])C([H])([H])C([H])([H])[C@@]21C([H])([H])[H])=O
InChIKey NPAGDVCDWIYMMC-IZPLOLCNSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

How is Nandrolone (CAS: 434-22-0) typically synthesized?

Nandrolone is typically synthesized via controlled reduction of androst-4-ene-3,17-dione using a hyd...

Compound Q&A

What industries use Nandrolone (CAS: 434-22-0)?

Nandrolone (CAS: 434-22-0) is primarily used in the pharmaceutical industry as an anabolic steroid. ...

Compound Q&A

What precautions should be taken when handling Nandrolone (CAS: 434-22-0)?

When handling Nandrolone (CAS: 434-22-0), it is crucial to wear appropriate personal protective equi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...