Compound Q&A

What are the physical and chemical properties of Apigenin 7-O-Glucuronide (CAS: 29741-09-1)?

Answer

Apigenin 7-O-Glucuronide
Apigenin 7-O-Glucuronide (CAS: 29741-09-1) is a white crystalline powder with a molecular weight of approximately 454.47 g/mol. It has a melting point of 235-237°C and is slightly soluble in water. This compound exhibits limited reactivity under normal conditions, but its solubility and reactivity can be influenced by pH and temperature.

About

CAS No 29741-09-1
English Name Apigenin 7-O-Glucuronide
Molecular Formula C21H18O11
Molecular Weight 446.36 g/mol
SMILES O[C@@H]1[C@@H](O)[C@H](OC2=CC3=C(C(O)=C2)C(=O)C=C(O3)C2=CC=C(O)C=C2)O[C@@H]([C@H]1O)C(O)=O
InChIKey JBFOLLJCGUCDQP-ZFORQUDYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

How is Apigenin 7-O-Glucuronide (CAS: 29741-09-1) typically synthesized?

Apigenin 7-O-Glucuronide (CAS: 29741-09-1) is typically synthesized through enzymatic glucuronidatio...

Compound Q&A

What industries use Apigenin 7-O-Glucuronide (CAS: 29741-09-1)?

Apigenin 7-O-Glucuronide (CAS: 29741-09-1) is used in the pharmaceutical industry for drug developme...

Compound Q&A

What precautions should be taken when handling Apigenin 7-O-Glucuronide (CAS: 29741-09-1)?

When handling Apigenin 7-O-Glucuronide (CAS: 29741-09-1), it is essential to wear appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...