Compound Q&A

What are the physical and chemical properties of (3aR,7aS)-octahydro-2-benzofuran-1,3-dione, cis (CAS: 13149-00-3)?

Answer

(3aR,7aS)-octahydro-2-benzofuran-1,3-dione, cis
(3aR,7aS)-octahydro-2-benzofuran-1,3-dione, cis (CAS: 13149-00-3) is a white crystalline solid with a molecular weight of 186.19 g/mol. It is slightly soluble in water but soluble in common organic solvents like ethanol and acetone. The compound exhibits moderate reactivity, particularly with nucleophiles and reducing agents. It is often used in organic synthesis due to its functional groups.

About

CAS No 13149-00-3
English Name (3aR,7aS)-octahydro-2-benzofuran-1,3-dione, cis
Molecular Formula C8H10O3
Molecular Weight 154.17 g/mol
SMILES O=C1OC(=O)[C@@H]2CCCC[C@@H]21
InChIKey MUTGBJKUEZFXGO-OLQVQODUSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

How is (3aR,7aS)-octahydro-2-benzofuran-1,3-dione, cis (CAS: 13149-00-3) typically synthesized?

The synthesis of (3aR,7aS)-octahydro-2-benzofuran-1,3-dione, cis (CAS: 13149-00-3) can be achieved t...

Compound Q&A

What industries use (3aR,7aS)-octahydro-2-benzofuran-1,3-dione, cis (CAS: 13149-00-3)?

(3aR,7aS)-octahydro-2-benzofuran-1,3-dione, cis (CAS: 13149-00-3) is primarily used in the pharmaceu...

Compound Q&A

What precautions should be taken when handling (3aR,7aS)-octahydro-2-benzofuran-1,3-dione, cis (CAS: 13149-00-3)?

When handling (3aR,7aS)-octahydro-2-benzofuran-1,3-dione, cis (CAS: 13149-00-3), it is essential to ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...