Compound Q&A

What are the physical and chemical properties of Bis(8-methylnonyl) phthalate (CAS: 26761-40-0)?

Answer

Bis(8-methylnonyl) phthalate
Bis(8-methylnonyl) phthalate (CAS: 26761-40-0) is a clear, colorless liquid with a molecular weight of approximately 438.6 g/mol. It has a low to moderate solubility in water but is soluble in common organic solvents like ethanol and acetone. Chemically, it is stable under normal conditions but can degrade under acidic or oxidative conditions.

About

CAS No 26761-40-0
English Name Bis(8-methylnonyl) phthalate
Molecular Formula C28H46O4
Molecular Weight 446.67 g/mol
SMILES O=C(OCCCCCCCC(C)C)C1=CC=CC=C1C(OCCCCCCCC(C)C)=O
InChIKey ZVFDTKUVRCTHQE-UHFFFAOYSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

How is Bis(8-methylnonyl) phthalate (CAS: 26761-40-0) typically synthesized?

Bis(8-methylnonyl) phthalate (CAS: 26761-40-0) is synthesized by reacting phthalic anhydride with 8-...

Compound Q&A

What industries use Bis(8-methylnonyl) phthalate (CAS: 26761-40-0)?

Bis(8-methylnonyl) phthalate (CAS: 26761-40-0) is commonly used in the polymer industry as a plastic...

Compound Q&A

What precautions should be taken when handling Bis(8-methylnonyl) phthalate (CAS: 26761-40-0)?

When handling Bis(8-methylnonyl) phthalate (CAS: 26761-40-0), it is essential to wear personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...