Compound Q&A

What are the physical and chemical properties of (2S)-2-Oxiranylmethyl 3-nitrobenzenesulfonate (CAS: 115314-14-2)?

Answer

(2S)-2-Oxiranylmethyl 3-nitrobenzenesulfonate
(2S)-2-Oxiranylmethyl 3-nitrobenzenesulfonate is a white, crystalline solid with a molecular weight of approximately 282.11 g/mol. It is slightly soluble in water and highly soluble in organic solvents such as ethanol and methanol. Chemically, it is reactive towards nucleophiles, particularly towards amines, which can lead to the formation of amides in a substitution reaction.

About

English Name (2S)-2-Oxiranylmethyl 3-nitrobenzenesulfonate
Molecular Formula C9H9NO6S
Molecular Weight 259.24 g/mol
SMILES C1C(O1)COS(=O)(=O)C2=CC=CC(=C2)[N+](=O)[O-]
InChIKey AIHIHVZYAAMDPM-QMMMGPOBSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

How is (2S)-2-Oxiranylmethyl 3-nitrobenzenesulfonate (CAS: 115314-14-2) typically synthesized?

(2S)-2-Oxiranylmethyl 3-nitrobenzenesulfonate is typically synthesized via the reaction of 3-nitrobe...

Compound Q&A

What industries use (2S)-2-Oxiranylmethyl 3-nitrobenzenesulfonate (CAS: 115314-14-2)?

(2S)-2-Oxiranylmethyl 3-nitrobenzenesulfonate finds applications in the pharmaceutical industry for ...

Compound Q&A

What precautions should be taken when handling (2S)-2-Oxiranylmethyl 3-nitrobenzenesulfonate (CAS: 115314-14-2)?

When handling (2S)-2-Oxiranylmethyl 3-nitrobenzenesulfonate, it is important to wear appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...