Compound Q&A

What are the physical and chemical properties of Methyl (6R)-5-acetamido-2,6-anhydro-4-azido-3,4,5-trideoxy-6-[(1S,2R)-1,2,3-triacetoxypropyl]-L-threo-hex-2-enonate (CAS: 130525-58-5)?

Answer

Methyl (6R)-5-acetamido-2,6-anhydro-4-azido-3,4,5-trideoxy-6-[(1S,2R)-1,2,3-triacetoxypropyl]-L-threo-hex-2-enonate
The compound is a crystalline solid with a molecular weight of approximately 631.5 g/mol. It is slightly soluble in water but highly soluble in organic solvents like methanol and DMSO. Chemically, it is reactive due to the presence of acetamido, azido, and acetoxy groups. It is stable in neutral and slightly acidic conditions but should be handled with care in basic environments.

About

English Name Methyl (6R)-5-acetamido-2,6-anhydro-4-azido-3,4,5-trideoxy-6-[(1S,2R)-1,2,3-triacetoxypropyl]-L-threo-hex-2-enonate
Molecular Formula C18H24N4O10
Molecular Weight 456.4 g/mol
SMILES CC(=O)NC1C(C=C(OC1C(C(COC(=O)C)OC(=O)C)OC(=O)C)C(=O)OC)N=[N+]=[N-]
InChIKey ANKWFOHGBMGGAL-IIHMKKKESA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

How is Methyl (6R)-5-acetamido-2,6-anhydro-4-azido-3,4,5-trideoxy-6-[(1S,2R)-1,2,3-triacetoxypropyl]-L-threo-hex-2-enonate (CAS: 130525-58-5) typically synthesized?

The compound can be synthesized through a multi-step process involving acetylation, azidation, and e...

Compound Q&A

What industries use Methyl (6R)-5-acetamido-2,6-anhydro-4-azido-3,4,5-trideoxy-6-[(1S,2R)-1,2,3-triacetoxypropyl]-L-threo-hex-2-enonate (CAS: 130525-58-5)?

This compound is primarily used in the pharmaceutical and chemical research industries for its uniqu...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...