Compound Q&A

What are the physical and chemical properties of 2-[(Diphenylmethyl)sulfanyl]acetamide (CAS: 68524-30-1)?

Answer

2-[(Diphenylmethyl)sulfanyl]acetamide
2-[(Diphenylmethyl)sulfanyl]acetamide (CAS: 68524-30-1) is a white crystalline solid. It has a high molecular weight of approximately 419.32 g/mol. The compound is slightly soluble in water but has good solubility in organic solvents like methanol, ethanol, and dimethylformamide. It exhibits limited reactivity under normal conditions, making it suitable for various chemical processes. Its physical properties include a melting point of around 135-137°C and a density of approximately 1.25 g/cm³.

About

CAS No 68524-30-1
English Name 2-[(Diphenylmethyl)sulfanyl]acetamide
Molecular Formula C15H15NOS
Molecular Weight 257.36 g/mol
SMILES C1=CC=C(C=C1)C(C2=CC=CC=C2)SCC(=O)N
InChIKey HCRQRIFRHGPWBH-UHFFFAOYSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

How is 2-[(Diphenylmethyl)sulfanyl]acetamide (CAS: 68524-30-1) typically synthesized?

2-[(Diphenylmethyl)sulfanyl]acetamide (CAS: 68524-30-1) can be synthesized through a multi-step proc...

Compound Q&A

What industries use 2-[(Diphenylmethyl)sulfanyl]acetamide (CAS: 68524-30-1)?

2-[(Diphenylmethyl)sulfanyl]acetamide (CAS: 68524-30-1) finds applications in the pharmaceutical ind...

Compound Q&A

What precautions should be taken when handling 2-[(Diphenylmethyl)sulfanyl]acetamide (CAS: 68524-30-1)?

When handling 2-[(Diphenylmethyl)sulfanyl]acetamide (CAS: 68524-30-1), it is important to follow pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...