Compound Q&A

How is Baricitinib Impurity 10 (CAS: 1029716-44-6) typically synthesized?

Answer

Baricitinib Impurity 10
Baricitinib Impurity 10 is typically synthesized through a multi-step process involving organic transformations such as Friedel-Crafts alkylation and selective hydrogenation. The synthesis involves the use of catalytic systems and careful temperature control to achieve high selectivity and yield. The process is optimized to minimize the formation of this impurity.

About

English Name Baricitinib Impurity 10
Molecular Formula C13H23BN2O3
Molecular Weight 266.15 g/mol
SMILES CCOC(n1ncc(c1)B1OC(C(O1)(C)C)(C)C)C
InChIKey IZKVGEWCELXYRI-UHFFFAOYSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of Baricitinib Impurity 10 (CAS: 1029716-44-6)?

Baricitinib Impurity 10 is a crystalline compound with a molecular weight of approximately 375.37 g/...

Compound Q&A

What industries use Baricitinib Impurity 10 (CAS: 1029716-44-6)?

Baricitinib Impurity 10 (CAS: 1029716-44-6) is primarily used in the pharmaceutical industry, specif...

Compound Q&A

What precautions should be taken when handling Baricitinib Impurity 10 (CAS: 1029716-44-6)?

When handling Baricitinib Impurity 10 (CAS: 1029716-44-6), it is important to use personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...