Compound Q&A

What are the physical and chemical properties of 2-Bromo-5-methoxybenzoic acid (CAS: 22921-68-2)?

Answer

2-Bromo-5-methoxybenzoic acid
2-Bromo-5-methoxybenzoic acid is a crystalline solid at room temperature. Its molecular weight is approximately 260.04 g/mol. It has a melting point of 159-160°C and is slightly soluble in water. The compound is reactive towards nucleophiles and can undergo bromination and methoxylation reactions. It is not flammable but can react with strong bases or reducing agents.

About

CAS No 22921-68-2
English Name 2-Bromo-5-methoxybenzoic acid
Molecular Formula C8H7BrO3
Molecular Weight 231.05 g/mol
SMILES COC1=CC(=C(C=C1)Br)C(=O)O
InChIKey ODHJOROUCITYNF-UHFFFAOYSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

How is 2-Bromo-5-methoxybenzoic acid (CAS: 22921-68-2) typically synthesized?

2-Bromo-5-methoxybenzoic acid can be synthesized by bromination of 5-methoxybenzoic acid followed by...

Compound Q&A

What industries use 2-Bromo-5-methoxybenzoic acid (CAS: 22921-68-2)?

2-Bromo-5-methoxybenzoic acid is used in the pharmaceutical industry as a precursor for the synthesi...

Compound Q&A

What precautions should be taken when handling 2-Bromo-5-methoxybenzoic acid (CAS: 22921-68-2)?

When handling 2-Bromo-5-methoxybenzoic acid, it is important to wear appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...