Compound Q&A

How is Josamycin (CAS: 16846-24-5) typically synthesized?

Answer

Josamycin
Josamycin (CAS: 16846-24-5) is typically synthesized through a semi-synthetic process involving modifications to the natural compound tylosin. The synthesis involves a series of chemical reactions, including acetylation, reduction, and epoxidation. Commonly used catalysts include metal complexes, and the overall yield can range from 50% to 70%. The process is selective and aims to preserve the macrolide ring structure, which is crucial for its biological activity.

About

CAS No 16846-24-5
English Name Josamycin
Molecular Formula C42H69NO15
Molecular Weight 828 g/mol
SMILES CC1CC=CC=CC(C(CC(C(C(C(CC(=O)O1)OC(=O)C)OC)OC2C(C(C(C(O2)C)OC3CC(C(C(O3)C)OC(=O)CC(C)C)(C)O)N(C)C)O)CC=O)C)O
InChIKey XJSFLOJWULLJQS-NGVXBBESSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of Josamycin (CAS: 16846-24-5)?

Josamycin (CAS: 16846-24-5) is a semi-synthetic macrolide antibiotic. It has a crystalline form with...

Compound Q&A

What industries use Josamycin (CAS: 16846-24-5)?

Josamycin (CAS: 16846-24-5) is primarily used in the pharmaceutical industry for its antibiotic prop...

Compound Q&A

What precautions should be taken when handling Josamycin (CAS: 16846-24-5)?

When handling Josamycin (CAS: 16846-24-5), it is important to wear appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...