Compound Q&A

How is Sodium 1,4-diethoxy-1,4-dioxo-2-butanolate (CAS: 40876-98-0) typically synthesized?

Answer

Sodium 1,4-diethoxy-1,4-dioxo-2-butanolate
Sodium 1,4-diethoxy-1,4-dioxo-2-butanolate is typically synthesized by treating 1,4-diethoxy-1,4-dioxo-2-butanone with sodium in an inert solvent like THF. The reaction is exothermic and requires careful control of temperature and environment to ensure high yield and selectivity.

About

CAS No 40876-98-0
English Name Sodium 1,4-diethoxy-1,4-dioxo-2-butanolate
Molecular Formula C8H13NaO5
Molecular Weight 210.16 g/mol
EINECS 255-122-9
SMILES [Na+].CCOC(=O)C=C([O-])C(=O)OCC
InChIKey PACMHGAHAZERQD-UHFFFAOYSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of Sodium 1,4-diethoxy-1,4-dioxo-2-butanolate (CAS: 40876-98-0)?

Sodium 1,4-diethoxy-1,4-dioxo-2-butanolate (CAS: 40876-98-0) is a crystalline solid with a molecular...

Compound Q&A

What industries use Sodium 1,4-diethoxy-1,4-dioxo-2-butanolate (CAS: 40876-98-0)?

Sodium 1,4-diethoxy-1,4-dioxo-2-butanolate (CAS: 40876-98-0) is primarily used in the pharmaceutical...

Compound Q&A

What precautions should be taken when handling Sodium 1,4-diethoxy-1,4-dioxo-2-butanolate (CAS: 40876-98-0)?

When handling Sodium 1,4-diethoxy-1,4-dioxo-2-butanolate (CAS: 40876-98-0), it is essential to use p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...