Compound Q&A

What industries use Tri-1-pyrrolidinyl(3H-[1,2,3]triazolo[4,5-b]pyridin-3-yloxy)phosphonium hexafluorophosphate (CAS: 156311-83-0)?

Answer

Tri-1-pyrrolidinyl(3H-[1,2,3]triazolo[4,5-b]pyridin-3-yloxy)phosphonium hexafluorophosphate
This compound is used in the pharmaceutical industry for its catalytic properties in organic synthesis. It is also used in polymer chemistry for the modification of polymers and in the semiconductor industry for its role in spin-coating processes. Additionally, it finds application in sensor technology due to its reactivity.

About

English Name Tri-1-pyrrolidinyl(3H-[1,2,3]triazolo[4,5-b]pyridin-3-yloxy)phosphonium hexafluorophosphate
Molecular Formula C17H27F6N7OP2
Molecular Weight 521.4 g/mol
SMILES C1CCN(C1)[P+](N2CCCC2)(N3CCCC3)ON4C5=C(C=CC=N5)N=N4.F[P-](F)(F)(F)(F)F
InChIKey CBZAHNDHLWAZQC-UHFFFAOYSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of Tri-1-pyrrolidinyl(3H-[1,2,3]triazolo[4,5-b]pyridin-3-yloxy)phosphonium hexafluorophosphate (CAS: 156311-83-0)?

This compound is a crystalline solid with a high molecular weight and low solubility in water. It ex...

Compound Q&A

How is Tri-1-pyrrolidinyl(3H-[1,2,3]triazolo[4,5-b]pyridin-3-yloxy)phosphonium hexafluorophosphate (CAS: 156311-83-0) typically synthesized?

This compound is typically synthesized through a multi-step process involving the reaction of pyrrol...

Compound Q&A

What precautions should be taken when handling Tri-1-pyrrolidinyl(3H-[1,2,3]triazolo[4,5-b]pyridin-3-yloxy)phosphonium hexafluorophosphate (CAS: 156311-83-0)?

When handling this compound, it is crucial to wear appropriate personal protective equipment (PPE), ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...