Compound Q&A

What industries use 1,2,3,4,5,6-Cyclohexanehexone (CAS: 527-31-1)?

Answer

1,2,3,4,5,6-Cyclohexanehexone
1,2,3,4,5,6-Cyclohexanehexone (CAS: 527-31-1) is used in the pharmaceutical industry for the synthesis of certain drug intermediates, in the polymer industry as a monomer in the production of specific polymers, and in the chemical industry for various organic synthesis applications. It is also utilized in the production of sensors and as a reagent in semiconductor manufacturing.

About

CAS No 527-31-1
English Name 1,2,3,4,5,6-Cyclohexanehexone
Molecular Formula C6O6
Molecular Weight 168.06 g/mol
SMILES C1(=O)C(=O)C(=O)C(=O)C(=O)C1=O
InChIKey PKRGYJHUXHCUCN-UHFFFAOYSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,2,3,4,5,6-Cyclohexanehexone (CAS: 527-31-1)?

1,2,3,4,5,6-Cyclohexanehexone (CAS: 527-31-1) is a colorless liquid with a molecular weight of appro...

Compound Q&A

How is 1,2,3,4,5,6-Cyclohexanehexone (CAS: 527-31-1) typically synthesized?

1,2,3,4,5,6-Cyclohexanehexone is typically synthesized via the oxidation of 1,2,3,4,5,6-hexahydroxyh...

Compound Q&A

What precautions should be taken when handling 1,2,3,4,5,6-Cyclohexanehexone (CAS: 527-31-1)?

When handling 1,2,3,4,5,6-Cyclohexanehexone (CAS: 527-31-1), it is essential to wear appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...