Compound Q&A

How is (2,2'-Bipyridine)-4,4'-dicarbaldehyde (CAS: 99970-84-0) typically synthesized?

Answer

[2,2'-Bipyridine]-4,4'-dicarbaldehyde
(2,2'-Bipyridine)-4,4'-dicarbaldehyde is usually synthesized by the alkylation of 4,4'-dihydroxybiphenyl with formaldehyde, followed by the oxidation of the resulting dihydroxy compound. This process typically involves the use of sodium hypochlorite as a catalyst, and the yield is generally around 70-80%. The reaction requires precise control of pH and temperature to achieve high selectivity and purity.

About

CAS No 99970-84-0
English Name [2,2'-Bipyridine]-4,4'-dicarbaldehyde
Molecular Formula C12H8N2O2
Molecular Weight 212.21 g/mol
SMILES C1=CN=C(C=C1C=O)C2=NC=CC(=C2)C=O
InChIKey UJCACAOPZBJKIW-UHFFFAOYSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2,2'-Bipyridine)-4,4'-dicarbaldehyde (CAS: 99970-84-0)?

(2,2'-Bipyridine)-4,4'-dicarbaldehyde (CAS: 99970-84-0) is a yellow solid with a molecular weight of...

Compound Q&A

What industries use (2,2'-Bipyridine)-4,4'-dicarbaldehyde (CAS: 99970-84-0)?

(2,2'-Bipyridine)-4,4'-dicarbaldehyde (CAS: 99970-84-0) finds applications in various industries. It...

Compound Q&A

What precautions should be taken when handling (2,2'-Bipyridine)-4,4'-dicarbaldehyde (CAS: 99970-84-0)?

When handling (2,2'-Bipyridine)-4,4'-dicarbaldehyde (CAS: 99970-84-0), it is important to wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...